C20H20F3NO4 — CID 155933878
2-benzamido-2-[5-methoxy-2-(4,4,4-trifluorobutyl)phenyl]acetic acid (PubChem CID 155933878) has the molecular formula C20H20F3NO4 and a molecular weight of 395.38 g/mol. Its IUPAC name is 2-benzamido-2-[5-methoxy-2-(4,4,4-trifluorobutyl)phenyl]acetic acid.
| Compound Name | 2-benzamido-2-[5-methoxy-2-(4,4,4-trifluorobutyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 155933878 |
| Molecular Formula | C20H20F3NO4 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-benzamido-2-[5-methoxy-2-(4,4,4-trifluorobutyl)phenyl]acetic acid |
| SMILES | COc1ccc(CCCC(F)(F)F)c(C(NC(=O)c2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C20H20F3NO4/c1-28-15-10-9-13(8-5-11-20(21,22)23)16(12-15)17(19(26)27)24-18(25)14-6-3-2-4-7-14/h2-4,6-7,9-10,12,17H,5,8,11H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | XQPQEAIMEPCBIY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |