C25H22F3NO3 — CID 155933876
2-benzamido-2-[4-phenyl-2-(4,4,4-trifluorobutyl)phenyl]acetic acid (PubChem CID 155933876) has the molecular formula C25H22F3NO3 and a molecular weight of 441.45 g/mol. Its IUPAC name is 2-benzamido-2-[4-phenyl-2-(4,4,4-trifluorobutyl)phenyl]acetic acid.
| Compound Name | 2-benzamido-2-[4-phenyl-2-(4,4,4-trifluorobutyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 155933876 |
| Molecular Formula | C25H22F3NO3 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 2-benzamido-2-[4-phenyl-2-(4,4,4-trifluorobutyl)phenyl]acetic acid |
| SMILES | O=C(NC(C(=O)O)c1ccc(-c2ccccc2)cc1CCCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C25H22F3NO3/c26-25(27,28)15-7-12-20-16-19(17-8-3-1-4-9-17)13-14-21(20)22(24(31)32)29-23(30)18-10-5-2-6-11-18/h1-6,8-11,13-14,16,22H,7,12,15H2,(H,29,30)(H,31,32) |
| InChIKey | MVQOFJRWTVAYMW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |