C26H22F3NO5 — CID 161124852
2-benzamido-2-[5-benzoyloxy-2-(4,4,4-trifluorobutyl)phenyl]acetic acid (PubChem CID 161124852) has the molecular formula C26H22F3NO5 and a molecular weight of 485.46 g/mol. Its IUPAC name is 2-benzamido-2-[5-benzoyloxy-2-(4,4,4-trifluorobutyl)phenyl]acetic acid.
| Compound Name | 2-benzamido-2-[5-benzoyloxy-2-(4,4,4-trifluorobutyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 161124852 |
| Molecular Formula | C26H22F3NO5 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 2-benzamido-2-[5-benzoyloxy-2-(4,4,4-trifluorobutyl)phenyl]acetic acid |
| SMILES | O=C(NC(C(=O)O)c1cc(OC(=O)c2ccccc2)ccc1CCCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C26H22F3NO5/c27-26(28,29)15-7-12-17-13-14-20(35-25(34)19-10-5-2-6-11-19)16-21(17)22(24(32)33)30-23(31)18-8-3-1-4-9-18/h1-6,8-11,13-14,16,22H,7,12,15H2,(H,30,31)(H,32,33) |
| InChIKey | ULKRBPJHWZCRHB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|