C32H43N3O2 — CID 160895652
4-butan-2-ylbenzonitrile;2-cyanoethyl 2,2-dimethylbutanoate;4-(2-methylbutan-2-yl)benzonitrile (PubChem CID 160895652) has the molecular formula C32H43N3O2 and a molecular weight of 501.72 g/mol. Its IUPAC name is 4-butan-2-ylbenzonitrile;2-cyanoethyl 2,2-dimethylbutanoate;4-(2-methylbutan-2-yl)benzonitrile.
| Compound Name | 4-butan-2-ylbenzonitrile;2-cyanoethyl 2,2-dimethylbutanoate;4-(2-methylbutan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 160895652 |
| Molecular Formula | C32H43N3O2 |
| Molecular Weight | 501.72 g/mol |
| Exact Mass | 501.34 |
| IUPAC Name | 4-butan-2-ylbenzonitrile;2-cyanoethyl 2,2-dimethylbutanoate;4-(2-methylbutan-2-yl)benzonitrile |
| SMILES | CCC(C)(C)C(=O)OCCC#N.CCC(C)(C)c1ccc(C#N)cc1.CCC(C)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C12H15N.C11H13N.C9H15NO2/c1-4-12(2,3)11-7-5-10(9-13)6-8-11;1-3-9(2)11-6-4-10(8-12)5-7-11;1-4-9(2,3)8(11)12-7-5-6-10/h5-8H,4H2,1-3H3;4-7,9H,3H2,1-2H3;4-5,7H2,1-3H3 |
| InChIKey | SOVNOFWHOBKOQH-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 97.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.72 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|