About 2-chloro-N-[3-[(1S,2R)-2-fluorocyclopropyl]-2H-pyrrol-5-yl]pyrimidin-4-amine
2-chloro-N-[3-[(1S,2R)-2-fluorocyclopropyl]-2H-pyrrol-5-yl]pyrimidin-4-amine (PubChem CID 160913484) has the molecular formula C11H10ClFN4
and a molecular weight of 252.68 g/mol. Its IUPAC name is 2-chloro-N-[3-[(1S,2R)-2-fluorocyclopropyl]-2H-pyrrol-5-yl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-[3-[(1S,2R)-2-fluorocyclopropyl]-2H-pyrrol-5-yl]pyrimidin-4-amine |
| PubChem CID | 160913484 |
| Molecular Formula | C11H10ClFN4 |
| Molecular Weight | 252.68 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-chloro-N-[3-[(1S,2R)-2-fluorocyclopropyl]-2H-pyrrol-5-yl]pyrimidin-4-amine |
| SMILES | F[C@@H]1C[C@H]1C1=CC(Nc2ccnc(Cl)n2)=NC1 |
| InChI | InChI=1S/C11H10ClFN4/c12-11-14-2-1-9(17-11)16-10-3-6(5-15-10)7-4-8(7)13/h1-3,7-8H,4-5H2,(H,14,15,16,17)/t7-,8+/m0/s1 |
| InChIKey | HWHLJKFSAXBUON-JGVFFNPUSA-N |
| XLogP | 2.24 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.68 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-[3-[(1S,2R)-2-fluorocyclopropyl]-2H-pyrrol-5-yl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[3-[(1S,2R)-2-fluorocyclopropyl]-2H-pyrrol-5-yl]pyrimidin-4-amine?
The IUPAC name of 2-chloro-N-[3-[(1S,2R)-2-fluorocyclopropyl]-2H-pyrrol-5-yl]pyrimidin-4-amine (CID 160913484) is 2-chloro-N-[3-[(1S,2R)-2-fluorocyclopropyl]-2H-pyrrol-5-yl]pyrimidin-4-amine.
What is the SMILES notation for 2-chloro-N-[3-[(1S,2R)-2-fluorocyclopropyl]-2H-pyrrol-5-yl]pyrimidin-4-amine?
The canonical SMILES for 2-chloro-N-[3-[(1S,2R)-2-fluorocyclopropyl]-2H-pyrrol-5-yl]pyrimidin-4-amine is F[C@@H]1C[C@H]1C1=CC(Nc2ccnc(Cl)n2)=NC1.
What is the InChIKey of 2-chloro-N-[3-[(1S,2R)-2-fluorocyclopropyl]-2H-pyrrol-5-yl]pyrimidin-4-amine?
The InChIKey is HWHLJKFSAXBUON-JGVFFNPUSA-N. The full InChI is InChI=1S/C11H10ClFN4/c12-11-14-2-1-9(17-11)16-10-3-6(5-15-10)7-4-8(7)13/h1-3,7-8H,4-5H2,(H,14,15,16,17)/t7-,8+/m0/s1.
What are the key properties of 2-chloro-N-[3-[(1S,2R)-2-fluorocyclopropyl]-2H-pyrrol-5-yl]pyrimidin-4-amine?
2-chloro-N-[3-[(1S,2R)-2-fluorocyclopropyl]-2H-pyrrol-5-yl]pyrimidin-4-amine has a molecular weight of 252.68 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[3-[(1S,2R)-2-fluorocyclopropyl]-2H-pyrrol-5-yl]pyrimidin-4-amine is sourced from PubChem (CID 160913484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).