C10H6B2BrFN5O5- — CID 160937538
CID 160937538 (PubChem CID 160937538) has the molecular formula C10H6B2BrFN5O5- and a molecular weight of 396.71 g/mol.
| Compound Name | CID 160937538 |
|---|---|
| PubChem CID | 160937538 |
| Molecular Formula | C10H6B2BrFN5O5- |
| Molecular Weight | 396.71 g/mol |
| Exact Mass | 395.97 |
| IUPAC Name | — |
| SMILES | O=c1onc(-c2nonc2[N+](=O)[O-])n1-c1ccc(F)c(Br)c1.[B][BH3-] |
| InChI | InChI=1S/C10H3BrFN5O5.B2H3/c11-5-3-4(1-2-6(5)12)16-8(14-21-10(16)18)7-9(17(19)20)15-22-13-7;1-2/h1-3H;1H3/q;-1 |
| InChIKey | AMNNMHGOYNKHAM-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 130.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.71 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|