C25H22F3NO3 — CID 160942507
(1-benzhydrylazetidin-3-yl) 2-[4-(trifluoromethoxy)phenyl]acetate (PubChem CID 160942507) has the molecular formula C25H22F3NO3 and a molecular weight of 441.45 g/mol. Its IUPAC name is (1-benzhydrylazetidin-3-yl) 2-[4-(trifluoromethoxy)phenyl]acetate.
| Compound Name | (1-benzhydrylazetidin-3-yl) 2-[4-(trifluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 160942507 |
| Molecular Formula | C25H22F3NO3 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (1-benzhydrylazetidin-3-yl) 2-[4-(trifluoromethoxy)phenyl]acetate |
| SMILES | O=C(Cc1ccc(OC(F)(F)F)cc1)OC1CN(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C25H22F3NO3/c26-25(27,28)32-21-13-11-18(12-14-21)15-23(30)31-22-16-29(17-22)24(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-14,22,24H,15-17H2 |
| InChIKey | SURLKYGSMDNVHM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |