C20H24N3O2+ — CID 163486748
[1-amino-3-(1-benzhydrylazetidin-3-yl)oxy-3-oxopropylidene]-methylazanium (PubChem CID 163486748) has the molecular formula C20H24N3O2+ and a molecular weight of 338.43 g/mol. Its IUPAC name is [1-amino-3-(1-benzhydrylazetidin-3-yl)oxy-3-oxopropylidene]-methylazanium.
| Compound Name | [1-amino-3-(1-benzhydrylazetidin-3-yl)oxy-3-oxopropylidene]-methylazanium |
|---|---|
| PubChem CID | 163486748 |
| Molecular Formula | C20H24N3O2+ |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | [1-amino-3-(1-benzhydrylazetidin-3-yl)oxy-3-oxopropylidene]-methylazanium |
| SMILES | C/[NH+]=C(\N)CC(=O)OC1CN(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C20H23N3O2/c1-22-18(21)12-19(24)25-17-13-23(14-17)20(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,17,20H,12-14H2,1H3,(H2,21,22)/p+1 |
| InChIKey | CJEPGJMSWITLJD-UHFFFAOYSA-O |
| XLogP | 0.46 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|