C24H21F2NO3 — CID 118685912
methyl 4-(1-benzhydrylazetidin-3-yl)oxy-3,5-difluorobenzoate (PubChem CID 118685912) has the molecular formula C24H21F2NO3 and a molecular weight of 409.43 g/mol. Its IUPAC name is methyl 4-(1-benzhydrylazetidin-3-yl)oxy-3,5-difluorobenzoate.
| Compound Name | methyl 4-(1-benzhydrylazetidin-3-yl)oxy-3,5-difluorobenzoate |
|---|---|
| PubChem CID | 118685912 |
| Molecular Formula | C24H21F2NO3 |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | methyl 4-(1-benzhydrylazetidin-3-yl)oxy-3,5-difluorobenzoate |
| SMILES | COC(=O)c1cc(F)c(OC2CN(C(c3ccccc3)c3ccccc3)C2)c(F)c1 |
| InChI | InChI=1S/C24H21F2NO3/c1-29-24(28)18-12-20(25)23(21(26)13-18)30-19-14-27(15-19)22(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-13,19,22H,14-15H2,1H3 |
| InChIKey | LCSWGHAKOMRMRM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |