C31H38N2O10 — CID 160948257
2-[bis(carboxymethyl)amino]-10-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]-8-oxodecanoic acid (PubChem CID 160948257) has the molecular formula C31H38N2O10 and a molecular weight of 598.65 g/mol. Its IUPAC name is 2-[bis(carboxymethyl)amino]-10-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]-8-oxodecanoic acid.
| Compound Name | 2-[bis(carboxymethyl)amino]-10-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]-8-oxodecanoic acid |
|---|---|
| PubChem CID | 160948257 |
| Molecular Formula | C31H38N2O10 |
| Molecular Weight | 598.65 g/mol |
| Exact Mass | 598.25 |
| IUPAC Name | 2-[bis(carboxymethyl)amino]-10-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]-8-oxodecanoic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(CCCCCC(=O)CCOCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C31H38N2O10/c34-21(8-2-1-3-13-27(30(39)40)33(18-28(35)36)19-29(37)38)14-16-42-17-15-32-31(41)43-20-26-24-11-6-4-9-22(24)23-10-5-7-12-25(23)26/h4-7,9-12,26-27H,1-3,8,13-20H2,(H,32,41)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | WVFLRIOHRCHBBH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 179.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.65 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|