C35H38N4O5 — CID 160954268
methane;1-[4-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]piperazin-1-yl]-2-(4-naphthalen-1-yloxyphenyl)ethanone (PubChem CID 160954268) has the molecular formula C35H38N4O5 and a molecular weight of 594.71 g/mol. Its IUPAC name is methane;1-[4-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]piperazin-1-yl]-2-(4-naphthalen-1-yloxyphenyl)ethanone.
| Compound Name | methane;1-[4-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]piperazin-1-yl]-2-(4-naphthalen-1-yloxyphenyl)ethanone |
|---|---|
| PubChem CID | 160954268 |
| Molecular Formula | C35H38N4O5 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | methane;1-[4-[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]piperazin-1-yl]-2-(4-naphthalen-1-yloxyphenyl)ethanone |
| SMILES | C.COCCOc1cc2ncnc(N3CCN(C(=O)Cc4ccc(Oc5cccc6ccccc56)cc4)CC3)c2cc1OC |
| InChI | InChI=1S/C34H34N4O5.CH4/c1-40-18-19-42-32-22-29-28(21-31(32)41-2)34(36-23-35-29)38-16-14-37(15-17-38)33(39)20-24-10-12-26(13-11-24)43-30-9-5-7-25-6-3-4-8-27(25)30;/h3-13,21-23H,14-20H2,1-2H3;1H4 |
| InChIKey | SWEBZIFORHINBZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|