About CID 160955383
CID 160955383 (PubChem CID 160955383) has the molecular formula C24H51Bi2
and a molecular weight of 757.63 g/mol.
Molecular Properties
| Compound Name | CID 160955383 |
| PubChem CID | 160955383 |
| Molecular Formula | C24H51Bi2 |
| Molecular Weight | 757.63 g/mol |
| Exact Mass | 757.36 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)C[Bi](CC(CC)CCCC)CC(CC)CCCC.[Bi] |
| InChI | InChI=1S/3C8H17.2Bi/c3*1-4-6-7-8(3)5-2;;/h3*8H,3-7H2,1-2H3;; |
| InChIKey | SWHWKDPOJGCVMX-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 757.63 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 160955383 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160955383?
The IUPAC name of CID 160955383 (CID 160955383) is not available.
What is the SMILES notation for CID 160955383?
The canonical SMILES for CID 160955383 is CCCCC(CC)C[Bi](CC(CC)CCCC)CC(CC)CCCC.[Bi].
What is the InChIKey of CID 160955383?
The InChIKey is SWHWKDPOJGCVMX-UHFFFAOYSA-N. The full InChI is InChI=1S/3C8H17.2Bi/c3*1-4-6-7-8(3)5-2;;/h3*8H,3-7H2,1-2H3;;.
What are the key properties of CID 160955383?
CID 160955383 has a molecular weight of 757.63 g/mol, XLogP of 8.75, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160955383 is sourced from PubChem (CID 160955383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).