C24H25F3N2O5 — CID 160956583
methyl 2-[[3-phenacyl-5-[4-(trifluoromethoxy)phenyl]piperidine-1-carbonyl]amino]acetate (PubChem CID 160956583) has the molecular formula C24H25F3N2O5 and a molecular weight of 478.47 g/mol. Its IUPAC name is methyl 2-[[3-phenacyl-5-[4-(trifluoromethoxy)phenyl]piperidine-1-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[3-phenacyl-5-[4-(trifluoromethoxy)phenyl]piperidine-1-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 160956583 |
| Molecular Formula | C24H25F3N2O5 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | methyl 2-[[3-phenacyl-5-[4-(trifluoromethoxy)phenyl]piperidine-1-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)N1CC(CC(=O)c2ccccc2)CC(c2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C24H25F3N2O5/c1-33-22(31)13-28-23(32)29-14-16(12-21(30)18-5-3-2-4-6-18)11-19(15-29)17-7-9-20(10-8-17)34-24(25,26)27/h2-10,16,19H,11-15H2,1H3,(H,28,32) |
| InChIKey | SWLUFYHEDXXWOE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |