C24H30BNO3 — CID 160962782
4,4-dimethyl-1-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyrrolidin-2-one (PubChem CID 160962782) has the molecular formula C24H30BNO3 and a molecular weight of 391.32 g/mol. Its IUPAC name is 4,4-dimethyl-1-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyrrolidin-2-one.
| Compound Name | 4,4-dimethyl-1-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 160962782 |
| Molecular Formula | C24H30BNO3 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 4,4-dimethyl-1-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]pyrrolidin-2-one |
| SMILES | CC1(C)CC(=O)N(c2ccc(-c3cccc(B4OC(C)(C)C(C)(C)O4)c3)cc2)C1 |
| InChI | InChI=1S/C24H30BNO3/c1-22(2)15-21(27)26(16-22)20-12-10-17(11-13-20)18-8-7-9-19(14-18)25-28-23(3,4)24(5,6)29-25/h7-14H,15-16H2,1-6H3 |
| InChIKey | SXFJKQIGLSRXEJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|