C16H24BN3O3S — CID 160982538
1-(1-ethoxyethenyl)-3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]thiourea (PubChem CID 160982538) has the molecular formula C16H24BN3O3S and a molecular weight of 349.27 g/mol. Its IUPAC name is 1-(1-ethoxyethenyl)-3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]thiourea.
| Compound Name | 1-(1-ethoxyethenyl)-3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]thiourea |
|---|---|
| PubChem CID | 160982538 |
| Molecular Formula | C16H24BN3O3S |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-(1-ethoxyethenyl)-3-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]thiourea |
| SMILES | C=C(NC(=S)Nc1cccc(B2OC(C)(C)C(C)(C)O2)n1)OCC |
| InChI | InChI=1S/C16H24BN3O3S/c1-7-21-11(2)18-14(24)20-13-10-8-9-12(19-13)17-22-15(3,4)16(5,6)23-17/h8-10H,2,7H2,1,3-6H3,(H2,18,19,20,24) |
| InChIKey | SZRWUCJOBKVVLR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 64.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|