C12H22N2O3 — CID 160982630
N,N-dimethylprop-2-enamide;N-(3-hydroxypropyl)-2-methylprop-2-enamide (PubChem CID 160982630) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is N,N-dimethylprop-2-enamide;N-(3-hydroxypropyl)-2-methylprop-2-enamide.
| Compound Name | N,N-dimethylprop-2-enamide;N-(3-hydroxypropyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 160982630 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | N,N-dimethylprop-2-enamide;N-(3-hydroxypropyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCO.C=CC(=O)N(C)C |
| InChI | InChI=1S/C7H13NO2.C5H9NO/c1-6(2)7(10)8-4-3-5-9;1-4-5(7)6(2)3/h9H,1,3-5H2,2H3,(H,8,10);4H,1H2,2-3H3 |
| InChIKey | SZSCXBSTWLIYRP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|