C16H23IO3 — CID 160986257
tert-butyl 4-(4-iodophenoxy)-3,3-dimethylbutanoate (PubChem CID 160986257) has the molecular formula C16H23IO3 and a molecular weight of 390.26 g/mol. Its IUPAC name is tert-butyl 4-(4-iodophenoxy)-3,3-dimethylbutanoate.
| Compound Name | tert-butyl 4-(4-iodophenoxy)-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 160986257 |
| Molecular Formula | C16H23IO3 |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | tert-butyl 4-(4-iodophenoxy)-3,3-dimethylbutanoate |
| SMILES | CC(C)(COc1ccc(I)cc1)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23IO3/c1-15(2,3)20-14(18)10-16(4,5)11-19-13-8-6-12(17)7-9-13/h6-9H,10-11H2,1-5H3 |
| InChIKey | PQWWVJVXEZOUCM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|