C13H21NO3 — CID 160990243
(3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol (PubChem CID 160990243) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol.
| Compound Name | (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol |
|---|---|
| PubChem CID | 160990243 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol |
| SMILES | CC[C@H](O)[C@H](CCO)C(O)Nc1ccccc1 |
| InChI | InChI=1S/C13H21NO3/c1-2-12(16)11(8-9-15)13(17)14-10-6-4-3-5-7-10/h3-7,11-17H,2,8-9H2,1H3/t11-,12-,13?/m0/s1 |
| InChIKey | LNKSQMRSUDNCKO-VYAYZGMFSA-N |
| XLogP | 1.19 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|