About (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol
(3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol (PubChem CID 160990243) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol.
Molecular Properties
| Compound Name | (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol |
| PubChem CID | 160990243 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol |
| SMILES | CC[C@H](O)[C@H](CCO)C(O)Nc1ccccc1 |
| InChI | InChI=1S/C13H21NO3/c1-2-12(16)11(8-9-15)13(17)14-10-6-4-3-5-7-10/h3-7,11-17H,2,8-9H2,1H3/t11-,12-,13?/m0/s1 |
| InChIKey | LNKSQMRSUDNCKO-VYAYZGMFSA-N |
| XLogP | 1.19 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol?
The IUPAC name of (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol (CID 160990243) is (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol.
What is the SMILES notation for (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol?
The canonical SMILES for (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol is CC[C@H](O)[C@H](CCO)C(O)Nc1ccccc1.
What is the InChIKey of (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol?
The InChIKey is LNKSQMRSUDNCKO-VYAYZGMFSA-N. The full InChI is InChI=1S/C13H21NO3/c1-2-12(16)11(8-9-15)13(17)14-10-6-4-3-5-7-10/h3-7,11-17H,2,8-9H2,1H3/t11-,12-,13?/m0/s1.
What are the key properties of (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol?
(3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol has a molecular weight of 239.31 g/mol, XLogP of 1.19, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-3-[anilino(hydroxy)methyl]hexane-1,4-diol is sourced from PubChem (CID 160990243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).