C29H25N — CID 160990308
1-(3,5-dimethylphenyl)-4,8-dimethyl-9-phenylbenzo[h]isoquinoline (PubChem CID 160990308) has the molecular formula C29H25N and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-4,8-dimethyl-9-phenylbenzo[h]isoquinoline.
| Compound Name | 1-(3,5-dimethylphenyl)-4,8-dimethyl-9-phenylbenzo[h]isoquinoline |
|---|---|
| PubChem CID | 160990308 |
| Molecular Formula | C29H25N |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-4,8-dimethyl-9-phenylbenzo[h]isoquinoline |
| SMILES | Cc1cc(C)cc(-c2ncc(C)c3ccc4cc(C)c(-c5ccccc5)cc4c23)c1 |
| InChI | InChI=1S/C29H25N/c1-18-12-19(2)14-24(13-18)29-28-25(21(4)17-30-29)11-10-23-15-20(3)26(16-27(23)28)22-8-6-5-7-9-22/h5-17H,1-4H3 |
| InChIKey | ZKIQUFNCNKVWFG-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|