C25H25NO2 — CID 160993571
4-ethynyl-N-[4-(3-phenylpropanoyl)hepta-1,6-dien-4-yl]benzamide (PubChem CID 160993571) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is 4-ethynyl-N-[4-(3-phenylpropanoyl)hepta-1,6-dien-4-yl]benzamide.
| Compound Name | 4-ethynyl-N-[4-(3-phenylpropanoyl)hepta-1,6-dien-4-yl]benzamide |
|---|---|
| PubChem CID | 160993571 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 4-ethynyl-N-[4-(3-phenylpropanoyl)hepta-1,6-dien-4-yl]benzamide |
| SMILES | C#Cc1ccc(C(=O)NC(CC=C)(CC=C)C(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO2/c1-4-18-25(19-5-2,23(27)17-14-21-10-8-7-9-11-21)26-24(28)22-15-12-20(6-3)13-16-22/h3-5,7-13,15-16H,1-2,14,17-19H2,(H,26,28) |
| InChIKey | TUYGVAPFCPVMIX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|