C33H34O2 — CID 166856963
4-[1-[4-[(4-ethynylphenyl)methyl]cyclohexyl]-2-methylidene-4-phenylbutyl]benzoic acid (PubChem CID 166856963) has the molecular formula C33H34O2 and a molecular weight of 462.63 g/mol. Its IUPAC name is 4-[1-[4-[(4-ethynylphenyl)methyl]cyclohexyl]-2-methylidene-4-phenylbutyl]benzoic acid.
| Compound Name | 4-[1-[4-[(4-ethynylphenyl)methyl]cyclohexyl]-2-methylidene-4-phenylbutyl]benzoic acid |
|---|---|
| PubChem CID | 166856963 |
| Molecular Formula | C33H34O2 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 4-[1-[4-[(4-ethynylphenyl)methyl]cyclohexyl]-2-methylidene-4-phenylbutyl]benzoic acid |
| SMILES | C#Cc1ccc(CC2CCC(C(C(=C)CCc3ccccc3)c3ccc(C(=O)O)cc3)CC2)cc1 |
| InChI | InChI=1S/C33H34O2/c1-3-25-11-13-27(14-12-25)23-28-15-17-29(18-16-28)32(30-19-21-31(22-20-30)33(34)35)24(2)9-10-26-7-5-4-6-8-26/h1,4-8,11-14,19-22,28-29,32H,2,9-10,15-18,23H2,(H,34,35) |
| InChIKey | DXOWYJAZLHPSCX-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|