C40H42 — CID 162484585
1-ethynyl-4-[[4-[2-methylidene-4-phenyl-1-[4-(3-prop-1-en-2-ylcyclopenta-2,4-dien-1-yl)phenyl]butyl]cyclohexyl]methyl]benzene (PubChem CID 162484585) has the molecular formula C40H42 and a molecular weight of 522.78 g/mol. Its IUPAC name is 1-ethynyl-4-[[4-[2-methylidene-4-phenyl-1-[4-(3-prop-1-en-2-ylcyclopenta-2,4-dien-1-yl)phenyl]butyl]cyclohexyl]methyl]benzene.
| Compound Name | 1-ethynyl-4-[[4-[2-methylidene-4-phenyl-1-[4-(3-prop-1-en-2-ylcyclopenta-2,4-dien-1-yl)phenyl]butyl]cyclohexyl]methyl]benzene |
|---|---|
| PubChem CID | 162484585 |
| Molecular Formula | C40H42 |
| Molecular Weight | 522.78 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | 1-ethynyl-4-[[4-[2-methylidene-4-phenyl-1-[4-(3-prop-1-en-2-ylcyclopenta-2,4-dien-1-yl)phenyl]butyl]cyclohexyl]methyl]benzene |
| SMILES | C#Cc1ccc(CC2CCC(C(C(=C)CCc3ccccc3)c3ccc(C4C=CC(C(=C)C)=C4)cc3)CC2)cc1 |
| InChI | InChI=1S/C40H42/c1-5-31-13-15-33(16-14-31)27-34-17-19-36(20-18-34)40(30(4)11-12-32-9-7-6-8-10-32)37-23-21-35(22-24-37)39-26-25-38(28-39)29(2)3/h1,6-10,13-16,21-26,28,34,36,39-40H,2,4,11-12,17-20,27H2,3H3 |
| InChIKey | DAOXOXKSNMZRAG-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.78 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|