C33H38 — CID 162485001
2-ethyl-4-[1-[4-[(4-ethynylphenyl)methyl]cyclohexyl]-2-methylprop-2-enyl]-1-(3-methylcyclopenta-1,4-dien-1-yl)benzene (PubChem CID 162485001) has the molecular formula C33H38 and a molecular weight of 434.67 g/mol. Its IUPAC name is 2-ethyl-4-[1-[4-[(4-ethynylphenyl)methyl]cyclohexyl]-2-methylprop-2-enyl]-1-(3-methylcyclopenta-1,4-dien-1-yl)benzene.
| Compound Name | 2-ethyl-4-[1-[4-[(4-ethynylphenyl)methyl]cyclohexyl]-2-methylprop-2-enyl]-1-(3-methylcyclopenta-1,4-dien-1-yl)benzene |
|---|---|
| PubChem CID | 162485001 |
| Molecular Formula | C33H38 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 2-ethyl-4-[1-[4-[(4-ethynylphenyl)methyl]cyclohexyl]-2-methylprop-2-enyl]-1-(3-methylcyclopenta-1,4-dien-1-yl)benzene |
| SMILES | C#Cc1ccc(CC2CCC(C(C(=C)C)c3ccc(C4=CC(C)C=C4)c(CC)c3)CC2)cc1 |
| InChI | InChI=1S/C33H38/c1-6-25-9-11-26(12-10-25)21-27-13-16-29(17-14-27)33(23(3)4)31-18-19-32(28(7-2)22-31)30-15-8-24(5)20-30/h1,8-12,15,18-20,22,24,27,29,33H,3,7,13-14,16-17,21H2,2,4-5H3 |
| InChIKey | LTFSOVOEQNUREG-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|