C41H42N2 — CID 162484595
5-[2-ethynyl-5-[[4-[1-[4-(3-methylcyclopenta-1,4-dien-1-yl)phenyl]-2-methylidene-4-phenylbutyl]cyclohexyl]methyl]phenyl]-1H-pyrazole (PubChem CID 162484595) has the molecular formula C41H42N2 and a molecular weight of 562.80 g/mol. Its IUPAC name is 5-[2-ethynyl-5-[[4-[1-[4-(3-methylcyclopenta-1,4-dien-1-yl)phenyl]-2-methylidene-4-phenylbutyl]cyclohexyl]methyl]phenyl]-1H-pyrazole.
| Compound Name | 5-[2-ethynyl-5-[[4-[1-[4-(3-methylcyclopenta-1,4-dien-1-yl)phenyl]-2-methylidene-4-phenylbutyl]cyclohexyl]methyl]phenyl]-1H-pyrazole |
|---|---|
| PubChem CID | 162484595 |
| Molecular Formula | C41H42N2 |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | 5-[2-ethynyl-5-[[4-[1-[4-(3-methylcyclopenta-1,4-dien-1-yl)phenyl]-2-methylidene-4-phenylbutyl]cyclohexyl]methyl]phenyl]-1H-pyrazole |
| SMILES | C#Cc1ccc(CC2CCC(C(C(=C)CCc3ccccc3)c3ccc(C4=CC(C)C=C4)cc3)CC2)cc1-c1ccn[nH]1 |
| InChI | InChI=1S/C41H42N2/c1-4-34-17-15-33(28-39(34)40-24-25-42-43-40)27-32-13-18-36(19-14-32)41(30(3)11-12-31-8-6-5-7-9-31)37-22-20-35(21-23-37)38-16-10-29(2)26-38/h1,5-10,15-17,20-26,28-29,32,36,41H,3,11-14,18-19,27H2,2H3,(H,42,43) |
| InChIKey | HYHFWZWPBOEIGP-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|