C45H50O — CID 162484832
1-[4-[[4-ethynyl-3-(4-methylidenecycloheptyl)phenyl]methyl]cyclohexyl]-1-[4-(3-methylcyclopenta-1,4-dien-1-yl)phenyl]-4-phenylbutan-2-one (PubChem CID 162484832) has the molecular formula C45H50O and a molecular weight of 606.89 g/mol. Its IUPAC name is 1-[4-[[4-ethynyl-3-(4-methylidenecycloheptyl)phenyl]methyl]cyclohexyl]-1-[4-(3-methylcyclopenta-1,4-dien-1-yl)phenyl]-4-phenylbutan-2-one.
| Compound Name | 1-[4-[[4-ethynyl-3-(4-methylidenecycloheptyl)phenyl]methyl]cyclohexyl]-1-[4-(3-methylcyclopenta-1,4-dien-1-yl)phenyl]-4-phenylbutan-2-one |
|---|---|
| PubChem CID | 162484832 |
| Molecular Formula | C45H50O |
| Molecular Weight | 606.89 g/mol |
| Exact Mass | 606.39 |
| IUPAC Name | 1-[4-[[4-ethynyl-3-(4-methylidenecycloheptyl)phenyl]methyl]cyclohexyl]-1-[4-(3-methylcyclopenta-1,4-dien-1-yl)phenyl]-4-phenylbutan-2-one |
| SMILES | C#Cc1ccc(CC2CCC(C(C(=O)CCc3ccccc3)c3ccc(C4=CC(C)C=C4)cc3)CC2)cc1C1CCCC(=C)CC1 |
| InChI | InChI=1S/C45H50O/c1-4-37-21-17-36(31-43(37)39-12-8-9-32(2)13-19-39)30-35-15-22-40(23-16-35)45(44(46)28-18-34-10-6-5-7-11-34)41-26-24-38(25-27-41)42-20-14-33(3)29-42/h1,5-7,10-11,14,17,20-21,24-27,29,31,33,35,39-40,45H,2,8-9,12-13,15-16,18-19,22-23,28,30H2,3H3 |
| InChIKey | VVMHESQHEIZKKE-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.89 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|