C44H52 — CID 162485030
2-(3,3-dimethylbutyl)-1-ethynyl-4-[[4-[1-[4-(3-methylcyclopenta-1,4-dien-1-yl)phenyl]-2-methylidene-4-phenylbutyl]cyclohexyl]methyl]benzene (PubChem CID 162485030) has the molecular formula C44H52 and a molecular weight of 580.90 g/mol. Its IUPAC name is 2-(3,3-dimethylbutyl)-1-ethynyl-4-[[4-[1-[4-(3-methylcyclopenta-1,4-dien-1-yl)phenyl]-2-methylidene-4-phenylbutyl]cyclohexyl]methyl]benzene.
| Compound Name | 2-(3,3-dimethylbutyl)-1-ethynyl-4-[[4-[1-[4-(3-methylcyclopenta-1,4-dien-1-yl)phenyl]-2-methylidene-4-phenylbutyl]cyclohexyl]methyl]benzene |
|---|---|
| PubChem CID | 162485030 |
| Molecular Formula | C44H52 |
| Molecular Weight | 580.90 g/mol |
| Exact Mass | 580.41 |
| IUPAC Name | 2-(3,3-dimethylbutyl)-1-ethynyl-4-[[4-[1-[4-(3-methylcyclopenta-1,4-dien-1-yl)phenyl]-2-methylidene-4-phenylbutyl]cyclohexyl]methyl]benzene |
| SMILES | C#Cc1ccc(CC2CCC(C(C(=C)CCc3ccccc3)c3ccc(C4=CC(C)C=C4)cc3)CC2)cc1CCC(C)(C)C |
| InChI | InChI=1S/C44H52/c1-7-37-20-18-36(31-42(37)27-28-44(4,5)6)30-35-16-21-39(22-17-35)43(33(3)14-15-34-11-9-8-10-12-34)40-25-23-38(24-26-40)41-19-13-32(2)29-41/h1,8-13,18-20,23-26,29,31-32,35,39,43H,3,14-17,21-22,27-28,30H2,2,4-6H3 |
| InChIKey | KCRHHSPXNCNACU-UHFFFAOYSA-N |
| XLogP | 11.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.90 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|