C22H23BrN2O7 — CID 160996621
3-[5-[(6-bromo-2-oxo-1H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrol-3-yl]propanoic acid;dimethyl propanedioate (PubChem CID 160996621) has the molecular formula C22H23BrN2O7 and a molecular weight of 507.34 g/mol. Its IUPAC name is 3-[5-[(6-bromo-2-oxo-1H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrol-3-yl]propanoic acid;dimethyl propanedioate.
| Compound Name | 3-[5-[(6-bromo-2-oxo-1H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrol-3-yl]propanoic acid;dimethyl propanedioate |
|---|---|
| PubChem CID | 160996621 |
| Molecular Formula | C22H23BrN2O7 |
| Molecular Weight | 507.34 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | 3-[5-[(6-bromo-2-oxo-1H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrol-3-yl]propanoic acid;dimethyl propanedioate |
| SMILES | COC(=O)CC(=O)OC.Cc1c(CCC(=O)O)c[nH]c1C=C1C(=O)Nc2cc(Br)ccc21 |
| InChI | InChI=1S/C17H15BrN2O3.C5H8O4/c1-9-10(2-5-16(21)22)8-19-14(9)7-13-12-4-3-11(18)6-15(12)20-17(13)23;1-8-4(6)3-5(7)9-2/h3-4,6-8,19H,2,5H2,1H3,(H,20,23)(H,21,22);3H2,1-2H3 |
| InChIKey | TVIHFUCXSCJZSC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|