C11H10BrNO3 — CID 76651421
6-bromo-3-(methoxymethoxymethylidene)-1H-indol-2-one (PubChem CID 76651421) has the molecular formula C11H10BrNO3 and a molecular weight of 284.11 g/mol. Its IUPAC name is 6-bromo-3-(methoxymethoxymethylidene)-1H-indol-2-one.
| Compound Name | 6-bromo-3-(methoxymethoxymethylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 76651421 |
| Molecular Formula | C11H10BrNO3 |
| Molecular Weight | 284.11 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 6-bromo-3-(methoxymethoxymethylidene)-1H-indol-2-one |
| SMILES | COCOC=C1C(=O)Nc2cc(Br)ccc21 |
| InChI | InChI=1S/C11H10BrNO3/c1-15-6-16-5-9-8-3-2-7(12)4-10(8)13-11(9)14/h2-5H,6H2,1H3,(H,13,14) |
| InChIKey | DEMLOPIXQGDPER-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.11 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|