C23H26BrNO2 — CID 85115768
6-bromo-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1H-indol-2-one (PubChem CID 85115768) has the molecular formula C23H26BrNO2 and a molecular weight of 428.37 g/mol. Its IUPAC name is 6-bromo-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1H-indol-2-one.
| Compound Name | 6-bromo-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 85115768 |
| Molecular Formula | C23H26BrNO2 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 6-bromo-3-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1H-indol-2-one |
| SMILES | CC(C)(C)c1cc(C=C2C(=O)Nc3cc(Br)ccc32)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C23H26BrNO2/c1-22(2,3)17-10-13(11-18(20(17)26)23(4,5)6)9-16-15-8-7-14(24)12-19(15)25-21(16)27/h7-12,26H,1-6H3,(H,25,27) |
| InChIKey | UKGAYXCYEVKLGE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|