C22H21BrN2O4 — CID 59406604
ethyl 3-[2-[(Z)-(6-bromo-2-oxo-1H-indol-3-ylidene)methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoate (PubChem CID 59406604) has the molecular formula C22H21BrN2O4 and a molecular weight of 457.32 g/mol. Its IUPAC name is ethyl 3-[2-[(Z)-(6-bromo-2-oxo-1H-indol-3-ylidene)methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoate.
| Compound Name | ethyl 3-[2-[(Z)-(6-bromo-2-oxo-1H-indol-3-ylidene)methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoate |
|---|---|
| PubChem CID | 59406604 |
| Molecular Formula | C22H21BrN2O4 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | ethyl 3-[2-[(Z)-(6-bromo-2-oxo-1H-indol-3-ylidene)methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoate |
| SMILES | CCOC(=O)CCc1c(/C=C2\C(=O)Nc3cc(Br)ccc32)[nH]c2c1C(=O)CCC2 |
| InChI | InChI=1S/C22H21BrN2O4/c1-2-29-20(27)9-8-14-18(24-16-4-3-5-19(26)21(14)16)11-15-13-7-6-12(23)10-17(13)25-22(15)28/h6-7,10-11,24H,2-5,8-9H2,1H3,(H,25,28)/b15-11- |
| InChIKey | QHOWWOYYKRSVSN-PTNGSMBKSA-N |
| XLogP | 4.28 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|