C23H23N2O4Y- — CID 59406641
ethyl 3-[2-[(Z)-(5-methyl-2-oxo-1,6-dihydroindol-6-id-3-ylidene)methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoate;yttrium (PubChem CID 59406641) has the molecular formula C23H23N2O4Y- and a molecular weight of 480.35 g/mol. Its IUPAC name is ethyl 3-[2-[(Z)-(5-methyl-2-oxo-1,6-dihydroindol-6-id-3-ylidene)methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoate;yttrium.
| Compound Name | ethyl 3-[2-[(Z)-(5-methyl-2-oxo-1,6-dihydroindol-6-id-3-ylidene)methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoate;yttrium |
|---|---|
| PubChem CID | 59406641 |
| Molecular Formula | C23H23N2O4Y- |
| Molecular Weight | 480.35 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | ethyl 3-[2-[(Z)-(5-methyl-2-oxo-1,6-dihydroindol-6-id-3-ylidene)methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoate;yttrium |
| SMILES | CCOC(=O)CCc1c(/C=C2\C(=O)Nc3c[c-]c(C)cc32)[nH]c2c1C(=O)CCC2.[Y] |
| InChI | InChI=1S/C23H23N2O4.Y/c1-3-29-21(27)10-8-14-19(24-18-5-4-6-20(26)22(14)18)12-16-15-11-13(2)7-9-17(15)25-23(16)28;/h9,11-12,24H,3-6,8,10H2,1-2H3,(H,25,28);/q-1;/b16-12-; |
| InChIKey | ZXJDEAPQWOCDHA-PXJKFVASSA-N |
| XLogP | 3.63 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|