C8H14Cl3F4N — CID 160996820
3-methylbutan-2-amine;1,1,3-trichloro-1,2,2,3-tetrafluoropropane (PubChem CID 160996820) has the molecular formula C8H14Cl3F4N and a molecular weight of 306.56 g/mol. Its IUPAC name is 3-methylbutan-2-amine;1,1,3-trichloro-1,2,2,3-tetrafluoropropane.
| Compound Name | 3-methylbutan-2-amine;1,1,3-trichloro-1,2,2,3-tetrafluoropropane |
|---|---|
| PubChem CID | 160996820 |
| Molecular Formula | C8H14Cl3F4N |
| Molecular Weight | 306.56 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 3-methylbutan-2-amine;1,1,3-trichloro-1,2,2,3-tetrafluoropropane |
| SMILES | CC(C)C(C)N.FC(Cl)C(F)(F)C(F)(Cl)Cl |
| InChI | InChI=1S/C5H13N.C3HCl3F4/c1-4(2)5(3)6;4-1(7)2(8,9)3(5,6)10/h4-5H,6H2,1-3H3;1H |
| InChIKey | TVIZDKQQJQYTKO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|