C43H52N3O7S+ — CID 161003993
2-[(E,3Z)-3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-1-[6-oxo-9-[[3-(2-oxoethoxy)benzoyl]amino]nonyl]indol-1-ium-5-sulfonic acid (PubChem CID 161003993) has the molecular formula C43H52N3O7S+ and a molecular weight of 754.97 g/mol. Its IUPAC name is 2-[(E,3Z)-3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-1-[6-oxo-9-[[3-(2-oxoethoxy)benzoyl]amino]nonyl]indol-1-ium-5-sulfonic acid.
| Compound Name | 2-[(E,3Z)-3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-1-[6-oxo-9-[[3-(2-oxoethoxy)benzoyl]amino]nonyl]indol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 161003993 |
| Molecular Formula | C43H52N3O7S+ |
| Molecular Weight | 754.97 g/mol |
| Exact Mass | 754.35 |
| IUPAC Name | 2-[(E,3Z)-3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-3,3-dimethyl-1-[6-oxo-9-[[3-(2-oxoethoxy)benzoyl]amino]nonyl]indol-1-ium-5-sulfonic acid |
| SMILES | CCN1/C(=C\C=C\C2=[N+](CCCCCC(=O)CCCNC(=O)c3cccc(OCC=O)c3)c3ccc(S(=O)(=O)O)cc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C43H51N3O7S/c1-6-45-37-20-10-9-19-35(37)42(2,3)39(45)21-13-22-40-43(4,5)36-30-34(54(50,51)52)23-24-38(36)46(40)26-11-7-8-16-32(48)17-14-25-44-41(49)31-15-12-18-33(29-31)53-28-27-47/h9-10,12-13,15,18-24,27,29-30H,6-8,11,14,16-17,25-26,28H2,1-5H3,(H-,44,49,50,51,52)/p+1 |
| InChIKey | UOXNOUMZLMNVJA-UHFFFAOYSA-O |
| XLogP | 7.48 |
| TPSA | 133.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.97 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|