C23H23BN2O6 — CID 161017676
5,6-dihydro-4H-benzo[de]quinolin-9-ylboronic acid;7-methoxy-8-nitro-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 161017676) has the molecular formula C23H23BN2O6 and a molecular weight of 434.26 g/mol. Its IUPAC name is 5,6-dihydro-4H-benzo[de]quinolin-9-ylboronic acid;7-methoxy-8-nitro-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 5,6-dihydro-4H-benzo[de]quinolin-9-ylboronic acid;7-methoxy-8-nitro-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 161017676 |
| Molecular Formula | C23H23BN2O6 |
| Molecular Weight | 434.26 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 5,6-dihydro-4H-benzo[de]quinolin-9-ylboronic acid;7-methoxy-8-nitro-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | COc1ccc2c(c1[N+](=O)[O-])C(=O)CCC2.OB(O)c1ccc2c3c(ccnc13)CCC2 |
| InChI | InChI=1S/C12H12BNO2.C11H11NO4/c15-13(16)10-5-4-8-2-1-3-9-6-7-14-12(10)11(8)9;1-16-9-6-5-7-3-2-4-8(13)10(7)11(9)12(14)15/h4-7,15-16H,1-3H2;5-6H,2-4H2,1H3 |
| InChIKey | TXYBHABQNBCXSA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 122.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|