C34H40BBr2IN2O4S2 — CID 161019311
1-bromo-3-iodobenzene;(3-bromophenyl)imino-dimethyl-oxo-λ6-sulfane;dimethyl-oxo-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]imino-λ6-sulfane (PubChem CID 161019311) has the molecular formula C34H40BBr2IN2O4S2 and a molecular weight of 902.36 g/mol. Its IUPAC name is 1-bromo-3-iodobenzene;(3-bromophenyl)imino-dimethyl-oxo-λ6-sulfane;dimethyl-oxo-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]imino-λ6-sulfane.
| Compound Name | 1-bromo-3-iodobenzene;(3-bromophenyl)imino-dimethyl-oxo-λ6-sulfane;dimethyl-oxo-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]imino-λ6-sulfane |
|---|---|
| PubChem CID | 161019311 |
| Molecular Formula | C34H40BBr2IN2O4S2 |
| Molecular Weight | 902.36 g/mol |
| Exact Mass | 899.99 |
| IUPAC Name | 1-bromo-3-iodobenzene;(3-bromophenyl)imino-dimethyl-oxo-λ6-sulfane;dimethyl-oxo-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]imino-λ6-sulfane |
| SMILES | Brc1cccc(I)c1.CC1(C)OB(c2ccc(-c3cccc(N=S(C)(C)=O)c3)cc2)OC1(C)C.CS(C)(=O)=Nc1cccc(Br)c1 |
| InChI | InChI=1S/C20H26BNO3S.C8H10BrNOS.C6H4BrI/c1-19(2)20(3,4)25-21(24-19)17-12-10-15(11-13-17)16-8-7-9-18(14-16)22-26(5,6)23;1-12(2,11)10-8-5-3-4-7(9)6-8;7-5-2-1-3-6(8)4-5/h7-14H,1-6H3;3-6H,1-2H3;1-4H |
| InChIKey | TYDOYLQXUNKLDE-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.36 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|