C26H17Cl4N3O3S2 — CID 161019336
(1R)-1-(2,6-dichlorothieno[2,3-b]pyridin-5-yl)ethanol;2-[(1S)-1-(2,6-dichlorothieno[2,3-b]pyridin-5-yl)ethyl]isoindole-1,3-dione (PubChem CID 161019336) has the molecular formula C26H17Cl4N3O3S2 and a molecular weight of 625.39 g/mol. Its IUPAC name is (1R)-1-(2,6-dichlorothieno[2,3-b]pyridin-5-yl)ethanol;2-[(1S)-1-(2,6-dichlorothieno[2,3-b]pyridin-5-yl)ethyl]isoindole-1,3-dione.
| Compound Name | (1R)-1-(2,6-dichlorothieno[2,3-b]pyridin-5-yl)ethanol;2-[(1S)-1-(2,6-dichlorothieno[2,3-b]pyridin-5-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 161019336 |
| Molecular Formula | C26H17Cl4N3O3S2 |
| Molecular Weight | 625.39 g/mol |
| Exact Mass | 622.95 |
| IUPAC Name | (1R)-1-(2,6-dichlorothieno[2,3-b]pyridin-5-yl)ethanol;2-[(1S)-1-(2,6-dichlorothieno[2,3-b]pyridin-5-yl)ethyl]isoindole-1,3-dione |
| SMILES | C[C@@H](O)c1cc2cc(Cl)sc2nc1Cl.C[C@@H](c1cc2cc(Cl)sc2nc1Cl)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H10Cl2N2O2S.C9H7Cl2NOS/c1-8(12-6-9-7-13(18)24-15(9)20-14(12)19)21-16(22)10-4-2-3-5-11(10)17(21)23;1-4(13)6-2-5-3-7(10)14-9(5)12-8(6)11/h2-8H,1H3;2-4,13H,1H3/t8-;4-/m01/s1 |
| InChIKey | TYDRCJJUWUEITB-ISITULPFSA-N |
| XLogP | 8.62 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.39 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|