C28H36N4O7 — CID 161045151
(2S)-6-amino-2-[[2-[4-[2-[4-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]carbamoyl]phenyl]ethynyl]phenyl]acetyl]amino]hexanoic acid;methane (PubChem CID 161045151) has the molecular formula C28H36N4O7 and a molecular weight of 540.62 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-[4-[2-[4-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]carbamoyl]phenyl]ethynyl]phenyl]acetyl]amino]hexanoic acid;methane.
| Compound Name | (2S)-6-amino-2-[[2-[4-[2-[4-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]carbamoyl]phenyl]ethynyl]phenyl]acetyl]amino]hexanoic acid;methane |
|---|---|
| PubChem CID | 161045151 |
| Molecular Formula | C28H36N4O7 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | (2S)-6-amino-2-[[2-[4-[2-[4-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]carbamoyl]phenyl]ethynyl]phenyl]acetyl]amino]hexanoic acid;methane |
| SMILES | C.C[C@@H](O)[C@H](NC(=O)c1ccc(C#Cc2ccc(CC(=O)N[C@@H](CCCCN)C(=O)O)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C27H32N4O7.CH4/c1-17(32)24(26(35)31-38)30-25(34)21-13-11-19(12-14-21)6-5-18-7-9-20(10-8-18)16-23(33)29-22(27(36)37)4-2-3-15-28;/h7-14,17,22,24,32,38H,2-4,15-16,28H2,1H3,(H,29,33)(H,30,34)(H,31,35)(H,36,37);1H4/t17-,22+,24+;/m1./s1 |
| InChIKey | UBKGMEXTUWKTLJ-HVTMGHLQSA-N |
| XLogP | 0.95 |
| TPSA | 191.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|