C31H29NO7 — CID 161064124
[4-[(E)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-hydroperoxybut-1-enyl]phenyl] 4-butoxybenzoate (PubChem CID 161064124) has the molecular formula C31H29NO7 and a molecular weight of 527.57 g/mol. Its IUPAC name is [4-[(E)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-hydroperoxybut-1-enyl]phenyl] 4-butoxybenzoate.
| Compound Name | [4-[(E)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-hydroperoxybut-1-enyl]phenyl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 161064124 |
| Molecular Formula | C31H29NO7 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | [4-[(E)-4-[4-(2,5-dioxopyrrol-1-yl)phenyl]-3-hydroperoxybut-1-enyl]phenyl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(/C=C/C(Cc3ccc(N4C(=O)C=CC4=O)cc3)OO)cc2)cc1 |
| InChI | InChI=1S/C31H29NO7/c1-2-3-20-37-26-16-9-24(10-17-26)31(35)38-27-13-6-22(7-14-27)8-15-28(39-36)21-23-4-11-25(12-5-23)32-29(33)18-19-30(32)34/h4-19,28,36H,2-3,20-21H2,1H3/b15-8+ |
| InChIKey | CJNFAAKHYPIURF-OVCLIPMQSA-N |
| XLogP | 5.63 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|