C9H21NO6S6 — CID 161081392
dimethylcarbamodithioic acid;3-(3-sulfopropyldisulfanyl)propane-1-sulfonic acid (PubChem CID 161081392) has the molecular formula C9H21NO6S6 and a molecular weight of 431.67 g/mol. Its IUPAC name is dimethylcarbamodithioic acid;3-(3-sulfopropyldisulfanyl)propane-1-sulfonic acid.
| Compound Name | dimethylcarbamodithioic acid;3-(3-sulfopropyldisulfanyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 161081392 |
| Molecular Formula | C9H21NO6S6 |
| Molecular Weight | 431.67 g/mol |
| Exact Mass | 430.97 |
| IUPAC Name | dimethylcarbamodithioic acid;3-(3-sulfopropyldisulfanyl)propane-1-sulfonic acid |
| SMILES | CN(C)C(=S)S.O=S(=O)(O)CCCSSCCCS(=O)(=O)O |
| InChI | InChI=1S/C6H14O6S4.C3H7NS2/c7-15(8,9)5-1-3-13-14-4-2-6-16(10,11)12;1-4(2)3(5)6/h1-6H2,(H,7,8,9)(H,10,11,12);1-2H3,(H,5,6) |
| InChIKey | UFYODBACOTWYQS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.67 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|