C12H26Na2O6S4 — CID 172839515
CID 172839515 (PubChem CID 172839515) has the molecular formula C12H26Na2O6S4 and a molecular weight of 440.58 g/mol.
| Compound Name | CID 172839515 |
|---|---|
| PubChem CID | 172839515 |
| Molecular Formula | C12H26Na2O6S4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)CCCCCCSSCCCCCCS(=O)(=O)O.[Na].[Na] |
| InChI | InChI=1S/C12H26O6S4.2Na/c13-21(14,15)11-7-3-1-5-9-19-20-10-6-2-4-8-12-22(16,17)18;;/h1-12H2,(H,13,14,15)(H,16,17,18);; |
| InChIKey | WPJHXCYTIXVQOY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|