C30H41N3 — CID 161085872
4-cyclopenta-2,4-dien-1-yl-1-N,1-N,2-N,2-N,3-N,3-N-hexaethyl-9H-fluorene-1,2,3-triamine (PubChem CID 161085872) has the molecular formula C30H41N3 and a molecular weight of 443.68 g/mol. Its IUPAC name is 4-cyclopenta-2,4-dien-1-yl-1-N,1-N,2-N,2-N,3-N,3-N-hexaethyl-9H-fluorene-1,2,3-triamine.
| Compound Name | 4-cyclopenta-2,4-dien-1-yl-1-N,1-N,2-N,2-N,3-N,3-N-hexaethyl-9H-fluorene-1,2,3-triamine |
|---|---|
| PubChem CID | 161085872 |
| Molecular Formula | C30H41N3 |
| Molecular Weight | 443.68 g/mol |
| Exact Mass | 443.33 |
| IUPAC Name | 4-cyclopenta-2,4-dien-1-yl-1-N,1-N,2-N,2-N,3-N,3-N-hexaethyl-9H-fluorene-1,2,3-triamine |
| SMILES | CCN(CC)c1c2c(c(C3C=CC=C3)c(N(CC)CC)c1N(CC)CC)-c1ccccc1C2 |
| InChI | InChI=1S/C30H41N3/c1-7-31(8-2)28-25-21-23-19-15-16-20-24(23)27(25)26(22-17-13-14-18-22)29(32(9-3)10-4)30(28)33(11-5)12-6/h13-20,22H,7-12,21H2,1-6H3 |
| InChIKey | UGMQUIAXIFEUDI-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.68 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|