C18H13Li — CID 161283415
lithium 2-cyclopenta-2,4-dien-1-yl-1,9-dihydrofluoren-1-ide (PubChem CID 161283415) has the molecular formula C18H13Li and a molecular weight of 236.24 g/mol. Its IUPAC name is lithium 2-cyclopenta-2,4-dien-1-yl-1,9-dihydrofluoren-1-ide.
| Compound Name | lithium 2-cyclopenta-2,4-dien-1-yl-1,9-dihydrofluoren-1-ide |
|---|---|
| PubChem CID | 161283415 |
| Molecular Formula | C18H13Li |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | lithium 2-cyclopenta-2,4-dien-1-yl-1,9-dihydrofluoren-1-ide |
| SMILES | [Li+].[c-]1c(C2C=CC=C2)ccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C18H13.Li/c1-2-6-13(5-1)14-9-10-18-16(11-14)12-15-7-3-4-8-17(15)18;/h1-10,13H,12H2;/q-1;+1 |
| InChIKey | LMCCCGVESRGCKP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|