C16H19O2Ti- — CID 174331013
methanol;2-methyl-1,9-dihydrofluoren-1-ide;titanium (PubChem CID 174331013) has the molecular formula C16H19O2Ti- and a molecular weight of 291.19 g/mol. Its IUPAC name is methanol;2-methyl-1,9-dihydrofluoren-1-ide;titanium.
| Compound Name | methanol;2-methyl-1,9-dihydrofluoren-1-ide;titanium |
|---|---|
| PubChem CID | 174331013 |
| Molecular Formula | C16H19O2Ti- |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | methanol;2-methyl-1,9-dihydrofluoren-1-ide;titanium |
| SMILES | CO.CO.Cc1[c-]c2c(cc1)-c1ccccc1C2.[Ti] |
| InChI | InChI=1S/C14H11.2CH4O.Ti/c1-10-6-7-14-12(8-10)9-11-4-2-3-5-13(11)14;2*1-2;/h2-7H,9H2,1H3;2*2H,1H3;/q-1;;; |
| InChIKey | MZOHNKPHJVNARA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|