C14H11Cl3Ti — CID 87704393
2-methyl-1,9-dihydrofluoren-1-ide;trichlorotitanium(1+) (PubChem CID 87704393) has the molecular formula C14H11Cl3Ti and a molecular weight of 333.47 g/mol. Its IUPAC name is 2-methyl-1,9-dihydrofluoren-1-ide;trichlorotitanium(1+).
| Compound Name | 2-methyl-1,9-dihydrofluoren-1-ide;trichlorotitanium(1+) |
|---|---|
| PubChem CID | 87704393 |
| Molecular Formula | C14H11Cl3Ti |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | 2-methyl-1,9-dihydrofluoren-1-ide;trichlorotitanium(1+) |
| SMILES | Cc1[c-]c2c(cc1)-c1ccccc1C2.Cl[Ti+](Cl)Cl |
| InChI | InChI=1S/C14H11.3ClH.Ti/c1-10-6-7-14-12(8-10)9-11-4-2-3-5-13(11)14;;;;/h2-7H,9H2,1H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | KVGLGXCTXVGXIG-UHFFFAOYSA-K |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|