C38H44N8O4 — CID 161086050
3-(3,5-dimethylphenyl)-5,5-dimethyl-1,2,4-oxadiazol-4-amine;1-[3-(3,5-dimethylphenyl)-5,5-dimethyl-1,2,4-oxadiazol-4-yl]-3-phenylurea;isocyanatobenzene (PubChem CID 161086050) has the molecular formula C38H44N8O4 and a molecular weight of 676.82 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-5,5-dimethyl-1,2,4-oxadiazol-4-amine;1-[3-(3,5-dimethylphenyl)-5,5-dimethyl-1,2,4-oxadiazol-4-yl]-3-phenylurea;isocyanatobenzene.
| Compound Name | 3-(3,5-dimethylphenyl)-5,5-dimethyl-1,2,4-oxadiazol-4-amine;1-[3-(3,5-dimethylphenyl)-5,5-dimethyl-1,2,4-oxadiazol-4-yl]-3-phenylurea;isocyanatobenzene |
|---|---|
| PubChem CID | 161086050 |
| Molecular Formula | C38H44N8O4 |
| Molecular Weight | 676.82 g/mol |
| Exact Mass | 676.35 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-5,5-dimethyl-1,2,4-oxadiazol-4-amine;1-[3-(3,5-dimethylphenyl)-5,5-dimethyl-1,2,4-oxadiazol-4-yl]-3-phenylurea;isocyanatobenzene |
| SMILES | Cc1cc(C)cc(C2=NOC(C)(C)N2N)c1.Cc1cc(C)cc(C2=NOC(C)(C)N2NC(=O)Nc2ccccc2)c1.O=C=Nc1ccccc1 |
| InChI | InChI=1S/C19H22N4O2.C12H17N3O.C7H5NO/c1-13-10-14(2)12-15(11-13)17-22-25-19(3,4)23(17)21-18(24)20-16-8-6-5-7-9-16;1-8-5-9(2)7-10(6-8)11-14-16-12(3,4)15(11)13;9-6-8-7-4-2-1-3-5-7/h5-12H,1-4H3,(H2,20,21,24);5-7H,13H2,1-4H3;1-5H |
| InChIKey | UGNHOCHLQOIMMA-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 146.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.82 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|