C22H26ClN5O2 — CID 161095720
(1S,4S,5S,7R)-5-chloro-7-[[6-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]methyl]bicyclo[2.2.1]heptan-2-ol (PubChem CID 161095720) has the molecular formula C22H26ClN5O2 and a molecular weight of 427.94 g/mol. Its IUPAC name is (1S,4S,5S,7R)-5-chloro-7-[[6-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]methyl]bicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1S,4S,5S,7R)-5-chloro-7-[[6-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]methyl]bicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 161095720 |
| Molecular Formula | C22H26ClN5O2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (1S,4S,5S,7R)-5-chloro-7-[[6-[[(2R)-1-hydroxy-3-phenylpropan-2-yl]amino]purin-9-yl]methyl]bicyclo[2.2.1]heptan-2-ol |
| SMILES | OC[C@@H](Cc1ccccc1)Nc1ncnc2c1ncn2C[C@H]1[C@@H]2CC(O)[C@H]1C[C@@H]2Cl |
| InChI | InChI=1S/C22H26ClN5O2/c23-18-7-16-17(15(18)8-19(16)30)9-28-12-26-20-21(24-11-25-22(20)28)27-14(10-29)6-13-4-2-1-3-5-13/h1-5,11-12,14-19,29-30H,6-10H2,(H,24,25,27)/t14-,15+,16+,17+,18+,19?/m1/s1 |
| InChIKey | UHTNPSGCAWDJAF-AQYUYFFZSA-N |
| XLogP | 2.47 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|