About methane;2-methylideneoxathiolane 2-oxide;oxolan-2-one
methane;2-methylideneoxathiolane 2-oxide;oxolan-2-one (PubChem CID 161097099) has the molecular formula C9H18O4S
and a molecular weight of 222.31 g/mol. Its IUPAC name is methane;2-methylideneoxathiolane 2-oxide;oxolan-2-one.
Molecular Properties
| Compound Name | methane;2-methylideneoxathiolane 2-oxide;oxolan-2-one |
| PubChem CID | 161097099 |
| Molecular Formula | C9H18O4S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | methane;2-methylideneoxathiolane 2-oxide;oxolan-2-one |
| SMILES | C.C=S1(=O)CCCO1.O=C1CCCO1 |
| InChI | InChI=1S/C4H8O2S.C4H6O2.CH4/c1-7(5)4-2-3-6-7;5-4-2-1-3-6-4;/h1-4H2;1-3H2;1H4 |
| InChIKey | UHXZBEUVYOSHRZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methane;2-methylideneoxathiolane 2-oxide;oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methylideneoxathiolane 2-oxide;oxolan-2-one?
The IUPAC name of methane;2-methylideneoxathiolane 2-oxide;oxolan-2-one (CID 161097099) is methane;2-methylideneoxathiolane 2-oxide;oxolan-2-one.
What is the SMILES notation for methane;2-methylideneoxathiolane 2-oxide;oxolan-2-one?
The canonical SMILES for methane;2-methylideneoxathiolane 2-oxide;oxolan-2-one is C.C=S1(=O)CCCO1.O=C1CCCO1.
What is the InChIKey of methane;2-methylideneoxathiolane 2-oxide;oxolan-2-one?
The InChIKey is UHXZBEUVYOSHRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2S.C4H6O2.CH4/c1-7(5)4-2-3-6-7;5-4-2-1-3-6-4;/h1-4H2;1-3H2;1H4.
What are the key properties of methane;2-methylideneoxathiolane 2-oxide;oxolan-2-one?
methane;2-methylideneoxathiolane 2-oxide;oxolan-2-one has a molecular weight of 222.31 g/mol, XLogP of 1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methylideneoxathiolane 2-oxide;oxolan-2-one is sourced from PubChem (CID 161097099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).