C17H14F10N2O2 — CID 161101779
4-(1,1,2,2,2-pentafluoroethoxy)aniline;[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methanamine (PubChem CID 161101779) has the molecular formula C17H14F10N2O2 and a molecular weight of 468.29 g/mol. Its IUPAC name is 4-(1,1,2,2,2-pentafluoroethoxy)aniline;[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methanamine.
| Compound Name | 4-(1,1,2,2,2-pentafluoroethoxy)aniline;[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 161101779 |
| Molecular Formula | C17H14F10N2O2 |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 4-(1,1,2,2,2-pentafluoroethoxy)aniline;[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methanamine |
| SMILES | NCc1ccc(OC(F)(F)C(F)(F)F)cc1.Nc1ccc(OC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H8F5NO.C8H6F5NO/c10-8(11,12)9(13,14)16-7-3-1-6(5-15)2-4-7;9-7(10,11)8(12,13)15-6-3-1-5(14)2-4-6/h1-4H,5,15H2;1-4H,14H2 |
| InChIKey | UINJQHLAPAWKGQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|