C11H16N4 — CID 161104893
N-[(1E)-1-(5-methyl-3-propan-2-yl-1,2,4-triazol-1-yl)buta-1,3-dienyl]methanimine (PubChem CID 161104893) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is N-[(1E)-1-(5-methyl-3-propan-2-yl-1,2,4-triazol-1-yl)buta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E)-1-(5-methyl-3-propan-2-yl-1,2,4-triazol-1-yl)buta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 161104893 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | N-[(1E)-1-(5-methyl-3-propan-2-yl-1,2,4-triazol-1-yl)buta-1,3-dienyl]methanimine |
| SMILES | C=C/C=C(\N=C)n1nc(C(C)C)nc1C |
| InChI | InChI=1S/C11H16N4/c1-6-7-10(12-5)15-9(4)13-11(14-15)8(2)3/h6-8H,1,5H2,2-4H3/b10-7+ |
| InChIKey | ALKHMEGWIBLAMA-JXMROGBWSA-N |
| XLogP | 2.39 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|