C12H22N4 — CID 165134075
ethane;(Z)-N-[5-propan-2-yl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-yl]ethanimine (PubChem CID 165134075) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is ethane;(Z)-N-[5-propan-2-yl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-yl]ethanimine.
| Compound Name | ethane;(Z)-N-[5-propan-2-yl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-yl]ethanimine |
|---|---|
| PubChem CID | 165134075 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | ethane;(Z)-N-[5-propan-2-yl-2-[(Z)-prop-1-enyl]-1,2,4-triazol-3-yl]ethanimine |
| SMILES | C/C=C\n1nc(C(C)C)nc1/N=C\C.CC |
| InChI | InChI=1S/C10H16N4.C2H6/c1-5-7-14-10(11-6-2)12-9(13-14)8(3)4;1-2/h5-8H,1-4H3;1-2H3/b7-5-,11-6-; |
| InChIKey | QSTAJSUUASDISN-RFUFMZOLSA-N |
| XLogP | 3.64 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|